Phenylcarbamic acid esters
eMolecules 78191-00-1 | N-Methoxy-N-methylacetamide | AA Blocks LLC | MFCD00060098 | 103.121 | C4H9NO2 | 0.000 | CON(C)C(C)=O | 10g | 436000787
N-Methoxy-N-methylacetamide | AA Blocks LLC | 78191-00-1 | MFCD00060098 | 103.121 | C4H9NO2 | 0.000 | CON(C)C(C)=O | 10g | 436000787
Medchemexpress LLC (S)-1-Boc-2-(aminomethyl)pyrrolidine | 119020-01-8 | 99.95% | 200.28 | 5 G
(S)-1-Boc-2-(aminomethyl)pyrrolidine is a biochemical reagent used as a biological material or organic compound in life science research. It functions as an intermediate in organic synthesis and as a chiral and heterocyclic building block in synthetic chemistry.
- Suitable for life science research
- Acts as an intermediate in organic synthesis
- Used as a chiral and heterocyclic building block
![eMolecules 220210-56-0 | {3-[(tert-butoxy)carbonyl]phenyl}boronic acid | Pharmablock | MFCD01630855 | 222.050 | C11H15BO4 | 97.000 | CC(C)(C)OC(=O)c1cccc(c1)B(O)O | 5g | 551080030](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000488328.jpg-250.jpg)
eMolecules 220210-56-0 | {3-[(tert-butoxy)carbonyl]phenyl}boronic acid | Pharmablock | MFCD01630855 | 222.050 | C11H15BO4 | 97.000 | CC(C)(C)OC(=O)c1cccc(c1)B(O)O | 5g | 551080030
{3-[(tert-butoxy)carbonyl]phenyl}boronic acid | Pharmablock | 220210-56-0 | MFCD01630855 | 222.050 | C11H15BO4 | 97.000 | CC(C)(C)OC(=O)c1cccc(c1)B(O)O | 5g | 551080030
eMolecules 639091-78-4 | 2-(Boc-amino)-4-(aminomethyl)pyridine | Accela ChemBio (ASD) | MFCD06213871 | 223.276 | C11H17N3O2 | 95.000 | CC(C)(C)OC(=O)Nc1cc(CN)ccn1 | 1g | 512018509
2-(Boc-amino)-4-(aminomethyl)pyridine | Accela ChemBio (ASD) | 639091-78-4 | MFCD06213871 | 223.276 | C11H17N3O2 | 95.000 | CC(C)(C)OC(=O)Nc1cc(CN)ccn1 | 1g | 512018509
Medchemexpress LLC Acid-PEG3-C2-Boc | 1807539-06-5 | ≥97.0% | 100 MG
Acid-PEG3-C2-Boc is a PEG- and Alkyl/ether-based PROTAC linker. It can be used in the synthesis of PROTACs for the degradation of EGFR and inhibition of mTOR. PROTACs utilize the intracellular ubiquitin-proteasome system to selectively degrade target proteins.
- Peg- and alkyl/ether-based protac linker
- Can be used in the synthesis of protacs
- Potential for degradation of egfr
- Potential for inhibition of mtor
Medchemexpress LLC Bromo-PEG1-C2-Boc | 1393330-36-3 | 98.58% | C9H17BrO3 | 250 MG
Bromo-PEG1-C2-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. These compounds contain two different ligands connected by a linker; one targets an E3 ubiquitin ligase, and the other targets a specific protein. PROTACs exploit the intracellular ubiquitin-proteasome system for the selective degradation of target proteins.
- Peg-based protac linker
- Used in the synthesis of protacs
- Contains two different ligands connected by a linker
- Ligand for an E3 ubiquitin ligase
- Ligand for target protein
- Exploits intracellular ubiquitin-proteasome system
- Selectively degrades target proteins
eMolecules 98-80-6 | Phenylboronic acid | Key Organics/BIONET | MFCD00002103 | 121.930 | C6H7BO2 | 95.000 | OB(O)c1ccccc1 | 5mg | 564101483
Phenylboronic acid | Key Organics/BIONET | 98-80-6 | MFCD00002103 | 121.930 | C6H7BO2 | 95.000 | OB(O)c1ccccc1 | 5mg | 564101483